C21H32N2O4S2 — CID 176809659
2-[2-[[2-(4-hydroxyphenyl)acetyl]amino]ethyldisulfanyl]ethyl 4-piperidin-1-ylbutanoate (PubChem CID 176809659) has the molecular formula C21H32N2O4S2 and a molecular weight of 440.63 g/mol. Its IUPAC name is 2-[2-[[2-(4-hydroxyphenyl)acetyl]amino]ethyldisulfanyl]ethyl 4-piperidin-1-ylbutanoate.
| Compound Name | 2-[2-[[2-(4-hydroxyphenyl)acetyl]amino]ethyldisulfanyl]ethyl 4-piperidin-1-ylbutanoate |
|---|---|
| PubChem CID | 176809659 |
| Molecular Formula | C21H32N2O4S2 |
| Molecular Weight | 440.63 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | 2-[2-[[2-(4-hydroxyphenyl)acetyl]amino]ethyldisulfanyl]ethyl 4-piperidin-1-ylbutanoate |
| SMILES | O=C(Cc1ccc(O)cc1)NCCSSCCOC(=O)CCCN1CCCCC1 |
| InChI | InChI=1S/C21H32N2O4S2/c24-19-8-6-18(7-9-19)17-20(25)22-10-15-28-29-16-14-27-21(26)5-4-13-23-11-2-1-3-12-23/h6-9,24H,1-5,10-17H2,(H,22,25) |
| InChIKey | PXDDFIWYTOEZAM-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.63 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|