C32H28O8S2 — CID 135032136
2,3,8,9,14,15,20,21-octamethoxy-25,26-dithiaheptacyclo[20.2.1.110,13.05,24.06,11.012,17.018,23]hexacosa-1(24),2,4,6,8,10,12,14,16,18,20,22-dodecaene (PubChem CID 135032136) has the molecular formula C32H28O8S2 and a molecular weight of 604.70 g/mol. Its IUPAC name is 2,3,8,9,14,15,20,21-octamethoxy-25,26-dithiaheptacyclo[20.2.1.110,13.05,24.06,11.012,17.018,23]hexacosa-1(24),2,4,6,8,10,12,14,16,18,20,22-dodecaene.
| Compound Name | 2,3,8,9,14,15,20,21-octamethoxy-25,26-dithiaheptacyclo[20.2.1.110,13.05,24.06,11.012,17.018,23]hexacosa-1(24),2,4,6,8,10,12,14,16,18,20,22-dodecaene |
|---|---|
| PubChem CID | 135032136 |
| Molecular Formula | C32H28O8S2 |
| Molecular Weight | 604.70 g/mol |
| Exact Mass | 604.12 |
| IUPAC Name | 2,3,8,9,14,15,20,21-octamethoxy-25,26-dithiaheptacyclo[20.2.1.110,13.05,24.06,11.012,17.018,23]hexacosa-1(24),2,4,6,8,10,12,14,16,18,20,22-dodecaene |
| SMILES | COc1cc2c3cc(OC)c(OC)c4sc5c(OC)c(OC)cc(c6cc(OC)c(OC)c7sc(c1OC)c2c76)c5c43 |
| InChI | InChI=1S/C32H28O8S2/c1-33-17-9-13-14-10-18(34-2)27(39-7)31-22(14)24-16(12-20(36-4)28(40-8)32(24)42-31)15-11-19(35-3)26(38-6)30-23(15)21(13)29(41-30)25(17)37-5/h9-12H,1-8H3/b14-13-,16-15- |
| InChIKey | XIWWQAPIZCOWIN-RFIZXXDFSA-N |
| XLogP | 8.24 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.70 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |