C34H30N2O6S — CID 71483633
3,19-bis(3,4,5-trimethoxyphenyl)-11-thia-3,19-diazapentacyclo[10.7.0.02,10.04,9.013,18]nonadeca-1(12),2(10),4,6,8,13,15,17-octaene (PubChem CID 71483633) has the molecular formula C34H30N2O6S and a molecular weight of 594.69 g/mol. Its IUPAC name is 3,19-bis(3,4,5-trimethoxyphenyl)-11-thia-3,19-diazapentacyclo[10.7.0.02,10.04,9.013,18]nonadeca-1(12),2(10),4,6,8,13,15,17-octaene.
| Compound Name | 3,19-bis(3,4,5-trimethoxyphenyl)-11-thia-3,19-diazapentacyclo[10.7.0.02,10.04,9.013,18]nonadeca-1(12),2(10),4,6,8,13,15,17-octaene |
|---|---|
| PubChem CID | 71483633 |
| Molecular Formula | C34H30N2O6S |
| Molecular Weight | 594.69 g/mol |
| Exact Mass | 594.18 |
| IUPAC Name | 3,19-bis(3,4,5-trimethoxyphenyl)-11-thia-3,19-diazapentacyclo[10.7.0.02,10.04,9.013,18]nonadeca-1(12),2(10),4,6,8,13,15,17-octaene |
| SMILES | COc1cc(-n2c3ccccc3c3sc4c5ccccc5n(-c5cc(OC)c(OC)c(OC)c5)c4c32)cc(OC)c1OC |
| InChI | InChI=1S/C34H30N2O6S/c1-37-25-15-19(16-26(38-2)31(25)41-5)35-23-13-9-7-11-21(23)33-29(35)30-34(43-33)22-12-8-10-14-24(22)36(30)20-17-27(39-3)32(42-6)28(18-20)40-4/h7-18H,1-6H3 |
| InChIKey | MFJIGQNNUBUYOX-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 65.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.69 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |