C17H13NOS — CID 164669908
4-(2-methoxyphenyl)thieno[3,2-b]indole (PubChem CID 164669908) has the molecular formula C17H13NOS and a molecular weight of 279.36 g/mol. Its IUPAC name is 4-(2-methoxyphenyl)thieno[3,2-b]indole.
| Compound Name | 4-(2-methoxyphenyl)thieno[3,2-b]indole |
|---|---|
| PubChem CID | 164669908 |
| Molecular Formula | C17H13NOS |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 4-(2-methoxyphenyl)thieno[3,2-b]indole |
| SMILES | COc1ccccc1-n1c2ccccc2c2sccc21 |
| InChI | InChI=1S/C17H13NOS/c1-19-16-9-5-4-8-14(16)18-13-7-3-2-6-12(13)17-15(18)10-11-20-17/h2-11H,1H3 |
| InChIKey | WSIOZOSSYNKOJZ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |