C9H4F3N3OS2 — CID 175674940
[2-amino-5-(trifluoromethoxy)-1,3-benzothiazol-6-yl] thiocyanate (PubChem CID 175674940) has the molecular formula C9H4F3N3OS2 and a molecular weight of 291.28 g/mol. Its IUPAC name is [2-amino-5-(trifluoromethoxy)-1,3-benzothiazol-6-yl] thiocyanate.
| Compound Name | [2-amino-5-(trifluoromethoxy)-1,3-benzothiazol-6-yl] thiocyanate |
|---|---|
| PubChem CID | 175674940 |
| Molecular Formula | C9H4F3N3OS2 |
| Molecular Weight | 291.28 g/mol |
| Exact Mass | 290.97 |
| IUPAC Name | [2-amino-5-(trifluoromethoxy)-1,3-benzothiazol-6-yl] thiocyanate |
| SMILES | N#CSc1cc2sc(N)nc2cc1OC(F)(F)F |
| InChI | InChI=1S/C9H4F3N3OS2/c10-9(11,12)16-5-1-4-6(18-8(14)15-4)2-7(5)17-3-13/h1-2H,(H2,14,15) |
| InChIKey | YRJKJJAHOONIQO-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.28 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|