C9H7F3N2OS — CID 87877149
5-methoxy-6-(trifluoromethyl)-1,3-benzothiazol-2-amine (PubChem CID 87877149) has the molecular formula C9H7F3N2OS and a molecular weight of 248.23 g/mol. Its IUPAC name is 5-methoxy-6-(trifluoromethyl)-1,3-benzothiazol-2-amine.
| Compound Name | 5-methoxy-6-(trifluoromethyl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 87877149 |
| Molecular Formula | C9H7F3N2OS |
| Molecular Weight | 248.23 g/mol |
| Exact Mass | 248.02 |
| IUPAC Name | 5-methoxy-6-(trifluoromethyl)-1,3-benzothiazol-2-amine |
| SMILES | COc1cc2nc(N)sc2cc1C(F)(F)F |
| InChI | InChI=1S/C9H7F3N2OS/c1-15-6-3-5-7(16-8(13)14-5)2-4(6)9(10,11)12/h2-3H,1H3,(H2,13,14) |
| InChIKey | BHHRLBAEGSRZDG-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.23 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |