C11H14N2OS — CID 45077485
5-methoxy-2-propan-2-yl-1,3-benzothiazol-6-amine (PubChem CID 45077485) has the molecular formula C11H14N2OS and a molecular weight of 222.31 g/mol. Its IUPAC name is 5-methoxy-2-propan-2-yl-1,3-benzothiazol-6-amine.
| Compound Name | 5-methoxy-2-propan-2-yl-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 45077485 |
| Molecular Formula | C11H14N2OS |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 5-methoxy-2-propan-2-yl-1,3-benzothiazol-6-amine |
| SMILES | COc1cc2nc(C(C)C)sc2cc1N |
| InChI | InChI=1S/C11H14N2OS/c1-6(2)11-13-8-5-9(14-3)7(12)4-10(8)15-11/h4-6H,12H2,1-3H3 |
| InChIKey | HRXWFMGBIFJJCJ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|