C13H14N4S — CID 117399668
5-(2-propan-2-yl-1,3-benzothiazol-5-yl)-1H-pyrazol-3-amine (PubChem CID 117399668) has the molecular formula C13H14N4S and a molecular weight of 258.35 g/mol. Its IUPAC name is 5-(2-propan-2-yl-1,3-benzothiazol-5-yl)-1H-pyrazol-3-amine.
| Compound Name | 5-(2-propan-2-yl-1,3-benzothiazol-5-yl)-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 117399668 |
| Molecular Formula | C13H14N4S |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 5-(2-propan-2-yl-1,3-benzothiazol-5-yl)-1H-pyrazol-3-amine |
| SMILES | CC(C)c1nc2cc(-c3cc(N)n[nH]3)ccc2s1 |
| InChI | InChI=1S/C13H14N4S/c1-7(2)13-15-10-5-8(3-4-11(10)18-13)9-6-12(14)17-16-9/h3-7H,1-2H3,(H3,14,16,17) |
| InChIKey | QPHUCGDOZYBIHA-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |