C14H20N2S — CID 22975278
6-tert-butyl-5-propan-2-yl-1,3-benzothiazol-2-amine (PubChem CID 22975278) has the molecular formula C14H20N2S and a molecular weight of 248.39 g/mol. Its IUPAC name is 6-tert-butyl-5-propan-2-yl-1,3-benzothiazol-2-amine.
| Compound Name | 6-tert-butyl-5-propan-2-yl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 22975278 |
| Molecular Formula | C14H20N2S |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 6-tert-butyl-5-propan-2-yl-1,3-benzothiazol-2-amine |
| SMILES | CC(C)c1cc2nc(N)sc2cc1C(C)(C)C |
| InChI | InChI=1S/C14H20N2S/c1-8(2)9-6-11-12(17-13(15)16-11)7-10(9)14(3,4)5/h6-8H,1-5H3,(H2,15,16) |
| InChIKey | SLCYKKGFEDHVGK-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |