C12H18N2S — CID 167552566
ethane;7-propan-2-yl-1,3-benzothiazol-2-amine (PubChem CID 167552566) has the molecular formula C12H18N2S and a molecular weight of 222.36 g/mol. Its IUPAC name is ethane;7-propan-2-yl-1,3-benzothiazol-2-amine.
| Compound Name | ethane;7-propan-2-yl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 167552566 |
| Molecular Formula | C12H18N2S |
| Molecular Weight | 222.36 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | ethane;7-propan-2-yl-1,3-benzothiazol-2-amine |
| SMILES | CC.CC(C)c1cccc2nc(N)sc12 |
| InChI | InChI=1S/C10H12N2S.C2H6/c1-6(2)7-4-3-5-8-9(7)13-10(11)12-8;1-2/h3-6H,1-2H3,(H2,11,12);1-2H3 |
| InChIKey | CPCXZZZBZFMTPR-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.36 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |