C8H5F3N2S2 — CID 2735964
6-(trifluoromethylsulfanyl)-1,3-benzothiazol-2-amine (PubChem CID 2735964) has the molecular formula C8H5F3N2S2 and a molecular weight of 250.27 g/mol. Its IUPAC name is 6-(trifluoromethylsulfanyl)-1,3-benzothiazol-2-amine.
| Compound Name | 6-(trifluoromethylsulfanyl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 2735964 |
| Molecular Formula | C8H5F3N2S2 |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 249.98 |
| IUPAC Name | 6-(trifluoromethylsulfanyl)-1,3-benzothiazol-2-amine |
| SMILES | Nc1nc2ccc(SC(F)(F)F)cc2s1 |
| InChI | InChI=1S/C8H5F3N2S2/c9-8(10,11)15-4-1-2-5-6(3-4)14-7(12)13-5/h1-3H,(H2,12,13) |
| InChIKey | PBRVVEXJMLEKMJ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |