C10H7F3N2OS — CID 10848903
[6-(trifluoromethoxy)-2,3-dihydro-1H-indol-5-yl] thiocyanate (PubChem CID 10848903) has the molecular formula C10H7F3N2OS and a molecular weight of 260.24 g/mol. Its IUPAC name is [6-(trifluoromethoxy)-2,3-dihydro-1H-indol-5-yl] thiocyanate.
| Compound Name | [6-(trifluoromethoxy)-2,3-dihydro-1H-indol-5-yl] thiocyanate |
|---|---|
| PubChem CID | 10848903 |
| Molecular Formula | C10H7F3N2OS |
| Molecular Weight | 260.24 g/mol |
| Exact Mass | 260.02 |
| IUPAC Name | [6-(trifluoromethoxy)-2,3-dihydro-1H-indol-5-yl] thiocyanate |
| SMILES | N#CSc1cc2c(cc1OC(F)(F)F)NCC2 |
| InChI | InChI=1S/C10H7F3N2OS/c11-10(12,13)16-8-4-7-6(1-2-15-7)3-9(8)17-5-14/h3-4,15H,1-2H2 |
| InChIKey | CAFZMDQOOXJMNZ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.24 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|