About 5-piperazin-1-ylsulfanyl-2,3-dihydro-1H-indole
5-piperazin-1-ylsulfanyl-2,3-dihydro-1H-indole (PubChem CID 176938208) has the molecular formula C12H17N3S
and a molecular weight of 235.36 g/mol. Its IUPAC name is 5-piperazin-1-ylsulfanyl-2,3-dihydro-1H-indole.
Molecular Properties
| Compound Name | 5-piperazin-1-ylsulfanyl-2,3-dihydro-1H-indole |
| PubChem CID | 176938208 |
| Molecular Formula | C12H17N3S |
| Molecular Weight | 235.36 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 5-piperazin-1-ylsulfanyl-2,3-dihydro-1H-indole |
| SMILES | c1cc2c(cc1SN1CCNCC1)CCN2 |
| InChI | InChI=1S/C12H17N3S/c1-2-12-10(3-4-14-12)9-11(1)16-15-7-5-13-6-8-15/h1-2,9,13-14H,3-8H2 |
| InChIKey | NQMNVGXOOWWIMC-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.36 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-piperazin-1-ylsulfanyl-2,3-dihydro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-piperazin-1-ylsulfanyl-2,3-dihydro-1H-indole?
The IUPAC name of 5-piperazin-1-ylsulfanyl-2,3-dihydro-1H-indole (CID 176938208) is 5-piperazin-1-ylsulfanyl-2,3-dihydro-1H-indole.
What is the SMILES notation for 5-piperazin-1-ylsulfanyl-2,3-dihydro-1H-indole?
The canonical SMILES for 5-piperazin-1-ylsulfanyl-2,3-dihydro-1H-indole is c1cc2c(cc1SN1CCNCC1)CCN2.
What is the InChIKey of 5-piperazin-1-ylsulfanyl-2,3-dihydro-1H-indole?
The InChIKey is NQMNVGXOOWWIMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3S/c1-2-12-10(3-4-14-12)9-11(1)16-15-7-5-13-6-8-15/h1-2,9,13-14H,3-8H2.
What are the key properties of 5-piperazin-1-ylsulfanyl-2,3-dihydro-1H-indole?
5-piperazin-1-ylsulfanyl-2,3-dihydro-1H-indole has a molecular weight of 235.36 g/mol, XLogP of 1.57, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-piperazin-1-ylsulfanyl-2,3-dihydro-1H-indole is sourced from PubChem (CID 176938208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).