C20H26N6S — CID 176938421
2-[4-(2,3-dihydro-1H-indol-5-ylsulfanyl)piperazin-1-yl]-6-methylpyrimidine-4-carbonitrile;ethane (PubChem CID 176938421) has the molecular formula C20H26N6S and a molecular weight of 382.54 g/mol. Its IUPAC name is 2-[4-(2,3-dihydro-1H-indol-5-ylsulfanyl)piperazin-1-yl]-6-methylpyrimidine-4-carbonitrile;ethane.
| Compound Name | 2-[4-(2,3-dihydro-1H-indol-5-ylsulfanyl)piperazin-1-yl]-6-methylpyrimidine-4-carbonitrile;ethane |
|---|---|
| PubChem CID | 176938421 |
| Molecular Formula | C20H26N6S |
| Molecular Weight | 382.54 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 2-[4-(2,3-dihydro-1H-indol-5-ylsulfanyl)piperazin-1-yl]-6-methylpyrimidine-4-carbonitrile;ethane |
| SMILES | CC.Cc1cc(C#N)nc(N2CCN(Sc3ccc4c(c3)CCN4)CC2)n1 |
| InChI | InChI=1S/C18H20N6S.C2H6/c1-13-10-15(12-19)22-18(21-13)23-6-8-24(9-7-23)25-16-2-3-17-14(11-16)4-5-20-17;1-2/h2-3,10-11,20H,4-9H2,1H3;1-2H3 |
| InChIKey | JDBLHTOVHWVQNA-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 68.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.54 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|