C14H20N2S — CID 117033861
1-(5,6,7,8-tetrahydronaphthalen-2-ylsulfanyl)piperazine (PubChem CID 117033861) has the molecular formula C14H20N2S and a molecular weight of 248.39 g/mol. Its IUPAC name is 1-(5,6,7,8-tetrahydronaphthalen-2-ylsulfanyl)piperazine.
| Compound Name | 1-(5,6,7,8-tetrahydronaphthalen-2-ylsulfanyl)piperazine |
|---|---|
| PubChem CID | 117033861 |
| Molecular Formula | C14H20N2S |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 1-(5,6,7,8-tetrahydronaphthalen-2-ylsulfanyl)piperazine |
| SMILES | c1cc2c(cc1SN1CCNCC1)CCCC2 |
| InChI | InChI=1S/C14H20N2S/c1-2-4-13-11-14(6-5-12(13)3-1)17-16-9-7-15-8-10-16/h5-6,11,15H,1-4,7-10H2 |
| InChIKey | HDFMNEBJOUYNLV-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|