C13H17NS — CID 62329474
3-(2,3-dihydro-1H-inden-5-ylsulfanyl)pyrrolidine (PubChem CID 62329474) has the molecular formula C13H17NS and a molecular weight of 219.35 g/mol. Its IUPAC name is 3-(2,3-dihydro-1H-inden-5-ylsulfanyl)pyrrolidine.
| Compound Name | 3-(2,3-dihydro-1H-inden-5-ylsulfanyl)pyrrolidine |
|---|---|
| PubChem CID | 62329474 |
| Molecular Formula | C13H17NS |
| Molecular Weight | 219.35 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 3-(2,3-dihydro-1H-inden-5-ylsulfanyl)pyrrolidine |
| SMILES | c1cc2c(cc1SC1CCNC1)CCC2 |
| InChI | InChI=1S/C13H17NS/c1-2-10-4-5-12(8-11(10)3-1)15-13-6-7-14-9-13/h4-5,8,13-14H,1-3,6-7,9H2 |
| InChIKey | ZOXBWBZQNYRNNY-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.35 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |