C14H20N2 — CID 82614224
3-(2,3-dihydro-1H-inden-5-yl)piperidin-4-amine (PubChem CID 82614224) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is 3-(2,3-dihydro-1H-inden-5-yl)piperidin-4-amine.
| Compound Name | 3-(2,3-dihydro-1H-inden-5-yl)piperidin-4-amine |
|---|---|
| PubChem CID | 82614224 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 3-(2,3-dihydro-1H-inden-5-yl)piperidin-4-amine |
| SMILES | NC1CCNCC1c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C14H20N2/c15-14-6-7-16-9-13(14)12-5-4-10-2-1-3-11(10)8-12/h4-5,8,13-14,16H,1-3,6-7,9,15H2 |
| InChIKey | MCSPWMCTNFAHMK-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |