C11H13N2O6PS — CID 22280362
(2-amino-7-ethoxycarbonyl-1,3-benzothiazol-4-yl)oxymethylphosphonic acid (PubChem CID 22280362) has the molecular formula C11H13N2O6PS and a molecular weight of 332.27 g/mol. Its IUPAC name is (2-amino-7-ethoxycarbonyl-1,3-benzothiazol-4-yl)oxymethylphosphonic acid.
| Compound Name | (2-amino-7-ethoxycarbonyl-1,3-benzothiazol-4-yl)oxymethylphosphonic acid |
|---|---|
| PubChem CID | 22280362 |
| Molecular Formula | C11H13N2O6PS |
| Molecular Weight | 332.27 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | (2-amino-7-ethoxycarbonyl-1,3-benzothiazol-4-yl)oxymethylphosphonic acid |
| SMILES | CCOC(=O)c1ccc(OCP(=O)(O)O)c2nc(N)sc12 |
| InChI | InChI=1S/C11H13N2O6PS/c1-2-18-10(14)6-3-4-7(19-5-20(15,16)17)8-9(6)21-11(12)13-8/h3-4H,2,5H2,1H3,(H2,12,13)(H2,15,16,17) |
| InChIKey | UJHNTVBPQKCKOV-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 131.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.27 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|