About 2-amino-5-(2-chloro-3,4-dimethoxyphenyl)-1,3-thiazole-4-carboxylic acid
2-amino-5-(2-chloro-3,4-dimethoxyphenyl)-1,3-thiazole-4-carboxylic acid (PubChem CID 106510015) has the molecular formula C12H11ClN2O4S
and a molecular weight of 314.75 g/mol. Its IUPAC name is 2-amino-5-(2-chloro-3,4-dimethoxyphenyl)-1,3-thiazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 2-amino-5-(2-chloro-3,4-dimethoxyphenyl)-1,3-thiazole-4-carboxylic acid |
| PubChem CID | 106510015 |
| Molecular Formula | C12H11ClN2O4S |
| Molecular Weight | 314.75 g/mol |
| Exact Mass | 314.01 |
| IUPAC Name | 2-amino-5-(2-chloro-3,4-dimethoxyphenyl)-1,3-thiazole-4-carboxylic acid |
| SMILES | COc1ccc(-c2sc(N)nc2C(=O)O)c(Cl)c1OC |
| InChI | InChI=1S/C12H11ClN2O4S/c1-18-6-4-3-5(7(13)9(6)19-2)10-8(11(16)17)15-12(14)20-10/h3-4H,1-2H3,(H2,14,15)(H,16,17) |
| InChIKey | ZWQMBTXVHYEDEG-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 94.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.75 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-amino-5-(2-chloro-3,4-dimethoxyphenyl)-1,3-thiazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-5-(2-chloro-3,4-dimethoxyphenyl)-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 2-amino-5-(2-chloro-3,4-dimethoxyphenyl)-1,3-thiazole-4-carboxylic acid (CID 106510015) is 2-amino-5-(2-chloro-3,4-dimethoxyphenyl)-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 2-amino-5-(2-chloro-3,4-dimethoxyphenyl)-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 2-amino-5-(2-chloro-3,4-dimethoxyphenyl)-1,3-thiazole-4-carboxylic acid is COc1ccc(-c2sc(N)nc2C(=O)O)c(Cl)c1OC.
What is the InChIKey of 2-amino-5-(2-chloro-3,4-dimethoxyphenyl)-1,3-thiazole-4-carboxylic acid?
The InChIKey is ZWQMBTXVHYEDEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11ClN2O4S/c1-18-6-4-3-5(7(13)9(6)19-2)10-8(11(16)17)15-12(14)20-10/h3-4H,1-2H3,(H2,14,15)(H,16,17).
What are the key properties of 2-amino-5-(2-chloro-3,4-dimethoxyphenyl)-1,3-thiazole-4-carboxylic acid?
2-amino-5-(2-chloro-3,4-dimethoxyphenyl)-1,3-thiazole-4-carboxylic acid has a molecular weight of 314.75 g/mol, XLogP of 2.76, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5-(2-chloro-3,4-dimethoxyphenyl)-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 106510015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).