C14H15ClN4O3S — CID 110510285
2-amino-N-[(Z)-(2-chloro-3,4-dimethoxyphenyl)methylideneamino]-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 110510285) has the molecular formula C14H15ClN4O3S and a molecular weight of 354.82 g/mol. Its IUPAC name is 2-amino-N-[(Z)-(2-chloro-3,4-dimethoxyphenyl)methylideneamino]-4-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-amino-N-[(Z)-(2-chloro-3,4-dimethoxyphenyl)methylideneamino]-4-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 110510285 |
| Molecular Formula | C14H15ClN4O3S |
| Molecular Weight | 354.82 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | 2-amino-N-[(Z)-(2-chloro-3,4-dimethoxyphenyl)methylideneamino]-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | COc1ccc(/C=N\NC(=O)c2sc(N)nc2C)c(Cl)c1OC |
| InChI | InChI=1S/C14H15ClN4O3S/c1-7-12(23-14(16)18-7)13(20)19-17-6-8-4-5-9(21-2)11(22-3)10(8)15/h4-6H,1-3H3,(H2,16,18)(H,19,20)/b17-6- |
| InChIKey | UBJDWSCMHRSZMK-FMQZQXMHSA-N |
| XLogP | 2.47 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.82 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|