C12H11ClN2O3S — CID 19375983
4-(2-chloro-3,4-dimethoxyphenyl)-1,3-thiazole-2-carboxamide (PubChem CID 19375983) has the molecular formula C12H11ClN2O3S and a molecular weight of 298.75 g/mol. Its IUPAC name is 4-(2-chloro-3,4-dimethoxyphenyl)-1,3-thiazole-2-carboxamide.
| Compound Name | 4-(2-chloro-3,4-dimethoxyphenyl)-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 19375983 |
| Molecular Formula | C12H11ClN2O3S |
| Molecular Weight | 298.75 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | 4-(2-chloro-3,4-dimethoxyphenyl)-1,3-thiazole-2-carboxamide |
| SMILES | COc1ccc(-c2csc(C(N)=O)n2)c(Cl)c1OC |
| InChI | InChI=1S/C12H11ClN2O3S/c1-17-8-4-3-6(9(13)10(8)18-2)7-5-19-12(15-7)11(14)16/h3-5H,1-2H3,(H2,14,16) |
| InChIKey | HMPRQIHNQZXYHC-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.75 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |