C14H15NO4S — CID 106510708
5-(2,4-dimethoxyphenyl)-2-ethyl-1,3-thiazole-4-carboxylic acid (PubChem CID 106510708) has the molecular formula C14H15NO4S and a molecular weight of 293.34 g/mol. Its IUPAC name is 5-(2,4-dimethoxyphenyl)-2-ethyl-1,3-thiazole-4-carboxylic acid.
| Compound Name | 5-(2,4-dimethoxyphenyl)-2-ethyl-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 106510708 |
| Molecular Formula | C14H15NO4S |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 5-(2,4-dimethoxyphenyl)-2-ethyl-1,3-thiazole-4-carboxylic acid |
| SMILES | CCc1nc(C(=O)O)c(-c2ccc(OC)cc2OC)s1 |
| InChI | InChI=1S/C14H15NO4S/c1-4-11-15-12(14(16)17)13(20-11)9-6-5-8(18-2)7-10(9)19-3/h5-7H,4H2,1-3H3,(H,16,17) |
| InChIKey | QVIRAUZUQZMOHS-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |