5-(3,5-dimethoxyphenyl)-2-ethyl-1,3-thiazole-4-carboxylic acid

C14H15NO4S — CID 106510719

IUPAC5-(3,5-dimethoxyphenyl)-2-ethyl-1,3-thiazole-4-carboxylic acid
SMILESCCc1nc(C(=O)O)c(-c2cc(OC)cc(OC)c2)s1
InChIInChI=1S/C14H15NO4S/c1-4-11-15-12(14(16)17)13(20-11)8-5-9(18-2)7-10(6-8)19-3/h5-7H,4H2,1-3H3,(H,16,17)
InChIKeyPCWJWWVNRBHWOT-UHFFFAOYSA-N
MW293.34 g/mol
LogP3.09
Rot. Bonds5

About 5-(3,5-dimethoxyphenyl)-2-ethyl-1,3-thiazole-4-carboxylic acid

5-(3,5-dimethoxyphenyl)-2-ethyl-1,3-thiazole-4-carboxylic acid (PubChem CID 106510719) has the molecular formula C14H15NO4S and a molecular weight of 293.34 g/mol. Its IUPAC name is 5-(3,5-dimethoxyphenyl)-2-ethyl-1,3-thiazole-4-carboxylic acid.

Molecular Properties

Compound Name5-(3,5-dimethoxyphenyl)-2-ethyl-1,3-thiazole-4-carboxylic acid
PubChem CID106510719
Molecular FormulaC14H15NO4S
Molecular Weight293.34 g/mol
Exact Mass293.07
IUPAC Name5-(3,5-dimethoxyphenyl)-2-ethyl-1,3-thiazole-4-carboxylic acid
SMILESCCc1nc(C(=O)O)c(-c2cc(OC)cc(OC)c2)s1
InChIInChI=1S/C14H15NO4S/c1-4-11-15-12(14(16)17)13(20-11)8-5-9(18-2)7-10(6-8)19-3/h5-7H,4H2,1-3H3,(H,16,17)
InChIKeyPCWJWWVNRBHWOT-UHFFFAOYSA-N
XLogP3.09
TPSA68.65 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500293.34
LogP ≤ 53.09
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 5-(3,5-dimethoxyphenyl)-2-ethyl-1,3-thiazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(3,5-dimethoxyphenyl)-2-ethyl-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 5-(3,5-dimethoxyphenyl)-2-ethyl-1,3-thiazole-4-carboxylic acid (CID 106510719) is 5-(3,5-dimethoxyphenyl)-2-ethyl-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 5-(3,5-dimethoxyphenyl)-2-ethyl-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 5-(3,5-dimethoxyphenyl)-2-ethyl-1,3-thiazole-4-carboxylic acid is CCc1nc(C(=O)O)c(-c2cc(OC)cc(OC)c2)s1.
What is the InChIKey of 5-(3,5-dimethoxyphenyl)-2-ethyl-1,3-thiazole-4-carboxylic acid?
The InChIKey is PCWJWWVNRBHWOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO4S/c1-4-11-15-12(14(16)17)13(20-11)8-5-9(18-2)7-10(6-8)19-3/h5-7H,4H2,1-3H3,(H,16,17).
What are the key properties of 5-(3,5-dimethoxyphenyl)-2-ethyl-1,3-thiazole-4-carboxylic acid?
5-(3,5-dimethoxyphenyl)-2-ethyl-1,3-thiazole-4-carboxylic acid has a molecular weight of 293.34 g/mol, XLogP of 3.09, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,5-dimethoxyphenyl)-2-ethyl-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 106510719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).