C15H17NO2S — CID 106510860
5-(3,5-dimethylphenyl)-2-propyl-1,3-thiazole-4-carboxylic acid (PubChem CID 106510860) has the molecular formula C15H17NO2S and a molecular weight of 275.37 g/mol. Its IUPAC name is 5-(3,5-dimethylphenyl)-2-propyl-1,3-thiazole-4-carboxylic acid.
| Compound Name | 5-(3,5-dimethylphenyl)-2-propyl-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 106510860 |
| Molecular Formula | C15H17NO2S |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | 5-(3,5-dimethylphenyl)-2-propyl-1,3-thiazole-4-carboxylic acid |
| SMILES | CCCc1nc(C(=O)O)c(-c2cc(C)cc(C)c2)s1 |
| InChI | InChI=1S/C15H17NO2S/c1-4-5-12-16-13(15(17)18)14(19-12)11-7-9(2)6-10(3)8-11/h6-8H,4-5H2,1-3H3,(H,17,18) |
| InChIKey | CDMUNSJKFOUSAW-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |