C16H14FN3O3S — CID 121082501
1-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-3-(4-fluorophenyl)urea (PubChem CID 121082501) has the molecular formula C16H14FN3O3S and a molecular weight of 347.37 g/mol. Its IUPAC name is 1-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-3-(4-fluorophenyl)urea.
| Compound Name | 1-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-3-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 121082501 |
| Molecular Formula | C16H14FN3O3S |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | 1-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-3-(4-fluorophenyl)urea |
| SMILES | COc1ccc(OC)c2sc(NC(=O)Nc3ccc(F)cc3)nc12 |
| InChI | InChI=1S/C16H14FN3O3S/c1-22-11-7-8-12(23-2)14-13(11)19-16(24-14)20-15(21)18-10-5-3-9(17)4-6-10/h3-8H,1-2H3,(H2,18,19,20,21) |
| InChIKey | XHLABOVVGWDZTL-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |