C17H13FN2O2S — CID 22283409
N-(7-ethenyl-4-methoxy-1,3-benzothiazol-2-yl)-4-fluorobenzamide (PubChem CID 22283409) has the molecular formula C17H13FN2O2S and a molecular weight of 328.37 g/mol. Its IUPAC name is N-(7-ethenyl-4-methoxy-1,3-benzothiazol-2-yl)-4-fluorobenzamide.
| Compound Name | N-(7-ethenyl-4-methoxy-1,3-benzothiazol-2-yl)-4-fluorobenzamide |
|---|---|
| PubChem CID | 22283409 |
| Molecular Formula | C17H13FN2O2S |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | N-(7-ethenyl-4-methoxy-1,3-benzothiazol-2-yl)-4-fluorobenzamide |
| SMILES | C=Cc1ccc(OC)c2nc(NC(=O)c3ccc(F)cc3)sc12 |
| InChI | InChI=1S/C17H13FN2O2S/c1-3-10-6-9-13(22-2)14-15(10)23-17(19-14)20-16(21)11-4-7-12(18)8-5-11/h3-9H,1H2,2H3,(H,19,20,21) |
| InChIKey | OQSNASYUFKOLQJ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |