C24H14O4 — CID 58090275
CID 58090275 (PubChem CID 58090275) has the molecular formula C24H14O4 and a molecular weight of 366.37 g/mol.
| Compound Name | CID 58090275 |
|---|---|
| PubChem CID | 58090275 |
| Molecular Formula | C24H14O4 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | — |
| SMILES | [CH]C(=O)Oc1ccc2ccccc2c1-c1c(OC([CH])=O)ccc2ccccc12 |
| InChI | InChI=1S/C24H14O4/c1-15(25)27-21-13-11-17-7-3-5-9-19(17)23(21)24-20-10-6-4-8-18(20)12-14-22(24)28-16(2)26/h1-14H |
| InChIKey | BJOCKJBXUDYKNB-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|