C24H16Cl2O4 — CID 25112232
2-[1-[2-(2-chloro-2-oxoethoxy)naphthalen-1-yl]naphthalen-2-yl]oxyacetyl chloride (PubChem CID 25112232) has the molecular formula C24H16Cl2O4 and a molecular weight of 439.29 g/mol. Its IUPAC name is 2-[1-[2-(2-chloro-2-oxoethoxy)naphthalen-1-yl]naphthalen-2-yl]oxyacetyl chloride.
| Compound Name | 2-[1-[2-(2-chloro-2-oxoethoxy)naphthalen-1-yl]naphthalen-2-yl]oxyacetyl chloride |
|---|---|
| PubChem CID | 25112232 |
| Molecular Formula | C24H16Cl2O4 |
| Molecular Weight | 439.29 g/mol |
| Exact Mass | 438.04 |
| IUPAC Name | 2-[1-[2-(2-chloro-2-oxoethoxy)naphthalen-1-yl]naphthalen-2-yl]oxyacetyl chloride |
| SMILES | O=C(Cl)COc1ccc2ccccc2c1-c1c(OCC(=O)Cl)ccc2ccccc12 |
| InChI | InChI=1S/C24H16Cl2O4/c25-21(27)13-29-19-11-9-15-5-1-3-7-17(15)23(19)24-18-8-4-2-6-16(18)10-12-20(24)30-14-22(26)28/h1-12H,13-14H2 |
| InChIKey | MENIEVQSYCIGNY-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.29 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|