C36H22Cl4O8 — CID 23064662
bis(carbonochloridic acid);4-[1-[2-(4-carbonochloridoylphenoxy)naphthalen-1-yl]naphthalen-2-yl]oxybenzoyl chloride (PubChem CID 23064662) has the molecular formula C36H22Cl4O8 and a molecular weight of 724.38 g/mol. Its IUPAC name is bis(carbonochloridic acid);4-[1-[2-(4-carbonochloridoylphenoxy)naphthalen-1-yl]naphthalen-2-yl]oxybenzoyl chloride.
| Compound Name | bis(carbonochloridic acid);4-[1-[2-(4-carbonochloridoylphenoxy)naphthalen-1-yl]naphthalen-2-yl]oxybenzoyl chloride |
|---|---|
| PubChem CID | 23064662 |
| Molecular Formula | C36H22Cl4O8 |
| Molecular Weight | 724.38 g/mol |
| Exact Mass | 722.01 |
| IUPAC Name | bis(carbonochloridic acid);4-[1-[2-(4-carbonochloridoylphenoxy)naphthalen-1-yl]naphthalen-2-yl]oxybenzoyl chloride |
| SMILES | O=C(Cl)c1ccc(Oc2ccc3ccccc3c2-c2c(Oc3ccc(C(=O)Cl)cc3)ccc3ccccc23)cc1.O=C(O)Cl.O=C(O)Cl |
| InChI | InChI=1S/C34H20Cl2O4.2CHClO2/c35-33(37)23-9-15-25(16-10-23)39-29-19-13-21-5-1-3-7-27(21)31(29)32-28-8-4-2-6-22(28)14-20-30(32)40-26-17-11-24(12-18-26)34(36)38;2*2-1(3)4/h1-20H;2*(H,3,4) |
| InChIKey | QZQOOFSSDMRVRY-UHFFFAOYSA-N |
| XLogP | 11.81 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.38 |
| LogP ≤ 5 | 11.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|