C23H14Cl2O4 — CID 143840570
[1-[2-(2-chloro-2-oxoethoxy)naphthalen-1-yl]naphthalen-2-yl] carbonochloridate (PubChem CID 143840570) has the molecular formula C23H14Cl2O4 and a molecular weight of 425.27 g/mol. Its IUPAC name is [1-[2-(2-chloro-2-oxoethoxy)naphthalen-1-yl]naphthalen-2-yl] carbonochloridate.
| Compound Name | [1-[2-(2-chloro-2-oxoethoxy)naphthalen-1-yl]naphthalen-2-yl] carbonochloridate |
|---|---|
| PubChem CID | 143840570 |
| Molecular Formula | C23H14Cl2O4 |
| Molecular Weight | 425.27 g/mol |
| Exact Mass | 424.03 |
| IUPAC Name | [1-[2-(2-chloro-2-oxoethoxy)naphthalen-1-yl]naphthalen-2-yl] carbonochloridate |
| SMILES | O=C(Cl)COc1ccc2ccccc2c1-c1c(OC(=O)Cl)ccc2ccccc12 |
| InChI | InChI=1S/C23H14Cl2O4/c24-20(26)13-28-18-11-9-14-5-1-3-7-16(14)21(18)22-17-8-4-2-6-15(17)10-12-19(22)29-23(25)27/h1-12H,13H2 |
| InChIKey | CAMGMAVPXUBNGH-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.27 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|