C26H19BrO6 — CID 10625421
[1-(2,3-diacetyloxy-4-bromonaphthalen-1-yl)naphthalen-2-yl] acetate (PubChem CID 10625421) has the molecular formula C26H19BrO6 and a molecular weight of 507.34 g/mol. Its IUPAC name is [1-(2,3-diacetyloxy-4-bromonaphthalen-1-yl)naphthalen-2-yl] acetate.
| Compound Name | [1-(2,3-diacetyloxy-4-bromonaphthalen-1-yl)naphthalen-2-yl] acetate |
|---|---|
| PubChem CID | 10625421 |
| Molecular Formula | C26H19BrO6 |
| Molecular Weight | 507.34 g/mol |
| Exact Mass | 506.04 |
| IUPAC Name | [1-(2,3-diacetyloxy-4-bromonaphthalen-1-yl)naphthalen-2-yl] acetate |
| SMILES | CC(=O)Oc1ccc2ccccc2c1-c1c(OC(C)=O)c(OC(C)=O)c(Br)c2ccccc12 |
| InChI | InChI=1S/C26H19BrO6/c1-14(28)31-21-13-12-17-8-4-5-9-18(17)22(21)23-19-10-6-7-11-20(19)24(27)26(33-16(3)30)25(23)32-15(2)29/h4-13H,1-3H3 |
| InChIKey | UIHIATJISQVPIG-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.34 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|