C20H14O8S2 — CID 67157811
[1-(2-sulfooxynaphthalen-1-yl)naphthalen-2-yl] hydrogen sulfate (PubChem CID 67157811) has the molecular formula C20H14O8S2 and a molecular weight of 446.46 g/mol. Its IUPAC name is [1-(2-sulfooxynaphthalen-1-yl)naphthalen-2-yl] hydrogen sulfate.
| Compound Name | [1-(2-sulfooxynaphthalen-1-yl)naphthalen-2-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 67157811 |
| Molecular Formula | C20H14O8S2 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.01 |
| IUPAC Name | [1-(2-sulfooxynaphthalen-1-yl)naphthalen-2-yl] hydrogen sulfate |
| SMILES | O=S(=O)(O)Oc1ccc2ccccc2c1-c1c(OS(=O)(=O)O)ccc2ccccc12 |
| InChI | InChI=1S/C20H14O8S2/c21-29(22,23)27-17-11-9-13-5-1-3-7-15(13)19(17)20-16-8-4-2-6-14(16)10-12-18(20)28-30(24,25)26/h1-12H,(H,21,22,23)(H,24,25,26) |
| InChIKey | SFTIWIUWPGWBOI-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|