C29H28O5 — CID 159337682
[1-oxo-7-(4-propylbenzoyl)oxy-2,3-dihydroinden-4-yl] 4-propylbenzoate (PubChem CID 159337682) has the molecular formula C29H28O5 and a molecular weight of 456.54 g/mol. Its IUPAC name is [1-oxo-7-(4-propylbenzoyl)oxy-2,3-dihydroinden-4-yl] 4-propylbenzoate.
| Compound Name | [1-oxo-7-(4-propylbenzoyl)oxy-2,3-dihydroinden-4-yl] 4-propylbenzoate |
|---|---|
| PubChem CID | 159337682 |
| Molecular Formula | C29H28O5 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | [1-oxo-7-(4-propylbenzoyl)oxy-2,3-dihydroinden-4-yl] 4-propylbenzoate |
| SMILES | CCCc1ccc(C(=O)Oc2ccc(OC(=O)c3ccc(CCC)cc3)c3c2CCC3=O)cc1 |
| InChI | InChI=1S/C29H28O5/c1-3-5-19-7-11-21(12-8-19)28(31)33-25-17-18-26(27-23(25)15-16-24(27)30)34-29(32)22-13-9-20(6-4-2)10-14-22/h7-14,17-18H,3-6,15-16H2,1-2H3 |
| InChIKey | BLMBNLZVPJMPSR-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|