C19H17ClO3 — CID 8910624
(4-methyl-8-oxo-6,7-dihydro-5H-naphthalen-1-yl) 2-(4-chlorophenyl)acetate (PubChem CID 8910624) has the molecular formula C19H17ClO3 and a molecular weight of 328.80 g/mol. Its IUPAC name is (4-methyl-8-oxo-6,7-dihydro-5H-naphthalen-1-yl) 2-(4-chlorophenyl)acetate.
| Compound Name | (4-methyl-8-oxo-6,7-dihydro-5H-naphthalen-1-yl) 2-(4-chlorophenyl)acetate |
|---|---|
| PubChem CID | 8910624 |
| Molecular Formula | C19H17ClO3 |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | (4-methyl-8-oxo-6,7-dihydro-5H-naphthalen-1-yl) 2-(4-chlorophenyl)acetate |
| SMILES | Cc1ccc(OC(=O)Cc2ccc(Cl)cc2)c2c1CCCC2=O |
| InChI | InChI=1S/C19H17ClO3/c1-12-5-10-17(19-15(12)3-2-4-16(19)21)23-18(22)11-13-6-8-14(20)9-7-13/h5-10H,2-4,11H2,1H3 |
| InChIKey | VRCABIFFKCOGQW-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|