C25H22O8 — CID 177224214
cyclohexyl 4,5-diacetyloxy-9,10-dioxoanthracene-2-carboxylate (PubChem CID 177224214) has the molecular formula C25H22O8 and a molecular weight of 450.44 g/mol. Its IUPAC name is cyclohexyl 4,5-diacetyloxy-9,10-dioxoanthracene-2-carboxylate.
| Compound Name | cyclohexyl 4,5-diacetyloxy-9,10-dioxoanthracene-2-carboxylate |
|---|---|
| PubChem CID | 177224214 |
| Molecular Formula | C25H22O8 |
| Molecular Weight | 450.44 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | cyclohexyl 4,5-diacetyloxy-9,10-dioxoanthracene-2-carboxylate |
| SMILES | CC(=O)Oc1cccc2c1C(=O)c1c(OC(C)=O)cc(C(=O)OC3CCCCC3)cc1C2=O |
| InChI | InChI=1S/C25H22O8/c1-13(26)31-19-10-6-9-17-21(19)24(29)22-18(23(17)28)11-15(12-20(22)32-14(2)27)25(30)33-16-7-4-3-5-8-16/h6,9-12,16H,3-5,7-8H2,1-2H3 |
| InChIKey | AVWZIJBASQIUAB-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.44 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|