C26H19NO7 — CID 57034588
[8-acetyloxy-6-[4-(methylcarbamoyl)phenyl]-9,10-dioxoanthracen-1-yl] acetate (PubChem CID 57034588) has the molecular formula C26H19NO7 and a molecular weight of 457.44 g/mol. Its IUPAC name is [8-acetyloxy-6-[4-(methylcarbamoyl)phenyl]-9,10-dioxoanthracen-1-yl] acetate.
| Compound Name | [8-acetyloxy-6-[4-(methylcarbamoyl)phenyl]-9,10-dioxoanthracen-1-yl] acetate |
|---|---|
| PubChem CID | 57034588 |
| Molecular Formula | C26H19NO7 |
| Molecular Weight | 457.44 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | [8-acetyloxy-6-[4-(methylcarbamoyl)phenyl]-9,10-dioxoanthracen-1-yl] acetate |
| SMILES | CNC(=O)c1ccc(-c2cc(OC(C)=O)c3c(c2)C(=O)c2cccc(OC(C)=O)c2C3=O)cc1 |
| InChI | InChI=1S/C26H19NO7/c1-13(28)33-20-6-4-5-18-22(20)25(31)23-19(24(18)30)11-17(12-21(23)34-14(2)29)15-7-9-16(10-8-15)26(32)27-3/h4-12H,1-3H3,(H,27,32) |
| InChIKey | HMGRHMNQIPNROI-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.44 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|