C28H21NO9 — CID 177224196
[4-(formamidomethyl)phenyl]methyl 4,5-diacetyloxy-9,10-dioxoanthracene-2-carboxylate (PubChem CID 177224196) has the molecular formula C28H21NO9 and a molecular weight of 515.47 g/mol. Its IUPAC name is [4-(formamidomethyl)phenyl]methyl 4,5-diacetyloxy-9,10-dioxoanthracene-2-carboxylate.
| Compound Name | [4-(formamidomethyl)phenyl]methyl 4,5-diacetyloxy-9,10-dioxoanthracene-2-carboxylate |
|---|---|
| PubChem CID | 177224196 |
| Molecular Formula | C28H21NO9 |
| Molecular Weight | 515.47 g/mol |
| Exact Mass | 515.12 |
| IUPAC Name | [4-(formamidomethyl)phenyl]methyl 4,5-diacetyloxy-9,10-dioxoanthracene-2-carboxylate |
| SMILES | CC(=O)Oc1cccc2c1C(=O)c1c(OC(C)=O)cc(C(=O)OCc3ccc(CNC=O)cc3)cc1C2=O |
| InChI | InChI=1S/C28H21NO9/c1-15(31)37-22-5-3-4-20-24(22)27(34)25-21(26(20)33)10-19(11-23(25)38-16(2)32)28(35)36-13-18-8-6-17(7-9-18)12-29-14-30/h3-11,14H,12-13H2,1-2H3,(H,29,30) |
| InChIKey | LPCISOQUFKBWDX-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 142.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.47 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|