C25H15F3N2O7 — CID 134153566
[8-acetyloxy-9,10-dioxo-6-[[5-(trifluoromethyl)-2-pyridinyl]carbamoyl]anthracen-1-yl] acetate (PubChem CID 134153566) has the molecular formula C25H15F3N2O7 and a molecular weight of 512.40 g/mol. Its IUPAC name is [8-acetyloxy-9,10-dioxo-6-[[5-(trifluoromethyl)-2-pyridinyl]carbamoyl]anthracen-1-yl] acetate.
| Compound Name | [8-acetyloxy-9,10-dioxo-6-[[5-(trifluoromethyl)-2-pyridinyl]carbamoyl]anthracen-1-yl] acetate |
|---|---|
| PubChem CID | 134153566 |
| Molecular Formula | C25H15F3N2O7 |
| Molecular Weight | 512.40 g/mol |
| Exact Mass | 512.08 |
| IUPAC Name | [8-acetyloxy-9,10-dioxo-6-[[5-(trifluoromethyl)-2-pyridinyl]carbamoyl]anthracen-1-yl] acetate |
| SMILES | CC(=O)Oc1cccc2c1C(=O)c1c(OC(C)=O)cc(C(=O)Nc3ccc(C(F)(F)F)cn3)cc1C2=O |
| InChI | InChI=1S/C25H15F3N2O7/c1-11(31)36-17-5-3-4-15-20(17)23(34)21-16(22(15)33)8-13(9-18(21)37-12(2)32)24(35)30-19-7-6-14(10-29-19)25(26,27)28/h3-10H,1-2H3,(H,29,30,35) |
| InChIKey | QBXLJGYNCCTRAB-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 128.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.40 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|