C26H29NO9S — CID 177224210
(8-acetyloxy-6-formyl-9,10-dioxoanthracen-1-yl) acetate;methane;N-[2-(2-methoxyethylsulfanyl)ethyl]formamide (PubChem CID 177224210) has the molecular formula C26H29NO9S and a molecular weight of 531.58 g/mol. Its IUPAC name is (8-acetyloxy-6-formyl-9,10-dioxoanthracen-1-yl) acetate;methane;N-[2-(2-methoxyethylsulfanyl)ethyl]formamide.
| Compound Name | (8-acetyloxy-6-formyl-9,10-dioxoanthracen-1-yl) acetate;methane;N-[2-(2-methoxyethylsulfanyl)ethyl]formamide |
|---|---|
| PubChem CID | 177224210 |
| Molecular Formula | C26H29NO9S |
| Molecular Weight | 531.58 g/mol |
| Exact Mass | 531.16 |
| IUPAC Name | (8-acetyloxy-6-formyl-9,10-dioxoanthracen-1-yl) acetate;methane;N-[2-(2-methoxyethylsulfanyl)ethyl]formamide |
| SMILES | C.CC(=O)Oc1cccc2c1C(=O)c1c(OC(C)=O)cc(C=O)cc1C2=O.COCCSCCNC=O |
| InChI | InChI=1S/C19H12O7.C6H13NO2S.CH4/c1-9(21)25-14-5-3-4-12-16(14)19(24)17-13(18(12)23)6-11(8-20)7-15(17)26-10(2)22;1-9-3-5-10-4-2-7-6-8;/h3-8H,1-2H3;6H,2-5H2,1H3,(H,7,8);1H4 |
| InChIKey | ALGNRGHWULMBND-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 142.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.58 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|