C23H16N2O7 — CID 57026988
4-(4,5-dimethoxy-9,10-dioxoanthracen-2-yl)-N-nitrobenzamide (PubChem CID 57026988) has the molecular formula C23H16N2O7 and a molecular weight of 432.39 g/mol. Its IUPAC name is 4-(4,5-dimethoxy-9,10-dioxoanthracen-2-yl)-N-nitrobenzamide.
| Compound Name | 4-(4,5-dimethoxy-9,10-dioxoanthracen-2-yl)-N-nitrobenzamide |
|---|---|
| PubChem CID | 57026988 |
| Molecular Formula | C23H16N2O7 |
| Molecular Weight | 432.39 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | 4-(4,5-dimethoxy-9,10-dioxoanthracen-2-yl)-N-nitrobenzamide |
| SMILES | COc1cccc2c1C(=O)c1c(OC)cc(-c3ccc(C(=O)N[N+](=O)[O-])cc3)cc1C2=O |
| InChI | InChI=1S/C23H16N2O7/c1-31-17-5-3-4-15-19(17)22(27)20-16(21(15)26)10-14(11-18(20)32-2)12-6-8-13(9-7-12)23(28)24-25(29)30/h3-11H,1-2H3,(H,24,28) |
| InChIKey | GOVPFAAPRBLSSD-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.39 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|