C51H50O12P2S — CID 46847139
5-[6-[2,2-bis[bis(phenylmethoxy)phosphoryl]ethylsulfanyl]hexoxy]-4-hydroxy-9,10-dioxoanthracene-2-carboxylic acid (PubChem CID 46847139) has the molecular formula C51H50O12P2S and a molecular weight of 948.96 g/mol. Its IUPAC name is 5-[6-[2,2-bis[bis(phenylmethoxy)phosphoryl]ethylsulfanyl]hexoxy]-4-hydroxy-9,10-dioxoanthracene-2-carboxylic acid.
| Compound Name | 5-[6-[2,2-bis[bis(phenylmethoxy)phosphoryl]ethylsulfanyl]hexoxy]-4-hydroxy-9,10-dioxoanthracene-2-carboxylic acid |
|---|---|
| PubChem CID | 46847139 |
| Molecular Formula | C51H50O12P2S |
| Molecular Weight | 948.96 g/mol |
| Exact Mass | 948.25 |
| IUPAC Name | 5-[6-[2,2-bis[bis(phenylmethoxy)phosphoryl]ethylsulfanyl]hexoxy]-4-hydroxy-9,10-dioxoanthracene-2-carboxylic acid |
| SMILES | O=C(O)c1cc(O)c2c(c1)C(=O)c1cccc(OCCCCCCSCC(P(=O)(OCc3ccccc3)OCc3ccccc3)P(=O)(OCc3ccccc3)OCc3ccccc3)c1C2=O |
| InChI | InChI=1S/C51H50O12P2S/c52-44-31-41(51(55)56)30-43-47(44)50(54)48-42(49(43)53)26-17-27-45(48)59-28-15-1-2-16-29-66-36-46(64(57,60-32-37-18-7-3-8-19-37)61-33-38-20-9-4-10-21-38)65(58,62-34-39-22-11-5-12-23-39)63-35-40-24-13-6-14-25-40/h3-14,17-27,30-31,46,52H,1-2,15-16,28-29,32-36H2,(H,55,56) |
| InChIKey | GJMNHFJAJQHJKD-UHFFFAOYSA-N |
| XLogP | 12.12 |
| TPSA | 171.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 948.96 |
| LogP ≤ 5 | 12.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|