C55H36O12 — CID 160936105
bis(1-acetyl-5-hydroxyanthracene-9,10-dione);1-acetyl-5-phenylmethoxyanthracene-9,10-dione (PubChem CID 160936105) has the molecular formula C55H36O12 and a molecular weight of 888.88 g/mol. Its IUPAC name is bis(1-acetyl-5-hydroxyanthracene-9,10-dione);1-acetyl-5-phenylmethoxyanthracene-9,10-dione.
| Compound Name | bis(1-acetyl-5-hydroxyanthracene-9,10-dione);1-acetyl-5-phenylmethoxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 160936105 |
| Molecular Formula | C55H36O12 |
| Molecular Weight | 888.88 g/mol |
| Exact Mass | 888.22 |
| IUPAC Name | bis(1-acetyl-5-hydroxyanthracene-9,10-dione);1-acetyl-5-phenylmethoxyanthracene-9,10-dione |
| SMILES | CC(=O)c1cccc2c1C(=O)c1cccc(O)c1C2=O.CC(=O)c1cccc2c1C(=O)c1cccc(O)c1C2=O.CC(=O)c1cccc2c1C(=O)c1cccc(OCc3ccccc3)c1C2=O |
| InChI | InChI=1S/C23H16O4.2C16H10O4/c1-14(24)16-9-5-10-17-20(16)22(25)18-11-6-12-19(21(18)23(17)26)27-13-15-7-3-2-4-8-15;2*1-8(17)9-4-2-5-10-13(9)15(19)11-6-3-7-12(18)14(11)16(10)20/h2-12H,13H2,1H3;2*2-7,18H,1H3 |
| InChIKey | STWVIIUTRLRPFS-UHFFFAOYSA-N |
| XLogP | 8.98 |
| TPSA | 203.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 67 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 888.88 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|