C33H28O7 — CID 56934692
(3R)-4-[9,10-dioxo-1,5-bis(phenylmethoxy)anthracen-2-yl]-3-hydroxy-3-methylbutanoic acid (PubChem CID 56934692) has the molecular formula C33H28O7 and a molecular weight of 536.58 g/mol. Its IUPAC name is (3R)-4-[9,10-dioxo-1,5-bis(phenylmethoxy)anthracen-2-yl]-3-hydroxy-3-methylbutanoic acid.
| Compound Name | (3R)-4-[9,10-dioxo-1,5-bis(phenylmethoxy)anthracen-2-yl]-3-hydroxy-3-methylbutanoic acid |
|---|---|
| PubChem CID | 56934692 |
| Molecular Formula | C33H28O7 |
| Molecular Weight | 536.58 g/mol |
| Exact Mass | 536.18 |
| IUPAC Name | (3R)-4-[9,10-dioxo-1,5-bis(phenylmethoxy)anthracen-2-yl]-3-hydroxy-3-methylbutanoic acid |
| SMILES | C[C@](O)(CC(=O)O)Cc1ccc2c(c1OCc1ccccc1)C(=O)c1cccc(OCc3ccccc3)c1C2=O |
| InChI | InChI=1S/C33H28O7/c1-33(38,18-27(34)35)17-23-15-16-25-29(32(23)40-20-22-11-6-3-7-12-22)31(37)24-13-8-14-26(28(24)30(25)36)39-19-21-9-4-2-5-10-21/h2-16,38H,17-20H2,1H3,(H,34,35)/t33-/m1/s1 |
| InChIKey | VUHKMGDFQICEBX-MGBGTMOVSA-N |
| XLogP | 5.39 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.58 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|