C18H24N2O5S — CID 174338786
2-amino-2-methyl-3-(2-phenylmethoxyphenyl)propanamide;methanesulfonic acid (PubChem CID 174338786) has the molecular formula C18H24N2O5S and a molecular weight of 380.47 g/mol. Its IUPAC name is 2-amino-2-methyl-3-(2-phenylmethoxyphenyl)propanamide;methanesulfonic acid.
| Compound Name | 2-amino-2-methyl-3-(2-phenylmethoxyphenyl)propanamide;methanesulfonic acid |
|---|---|
| PubChem CID | 174338786 |
| Molecular Formula | C18H24N2O5S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | 2-amino-2-methyl-3-(2-phenylmethoxyphenyl)propanamide;methanesulfonic acid |
| SMILES | CC(N)(Cc1ccccc1OCc1ccccc1)C(N)=O.CS(=O)(=O)O |
| InChI | InChI=1S/C17H20N2O2.CH4O3S/c1-17(19,16(18)20)11-14-9-5-6-10-15(14)21-12-13-7-3-2-4-8-13;1-5(2,3)4/h2-10H,11-12,19H2,1H3,(H2,18,20);1H3,(H,2,3,4) |
| InChIKey | KUQLGFNYICGLEW-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 132.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|