C17H23N3O5S — CID 174299048
2-amino-2-methyl-3-[4-(pyridin-4-ylmethoxy)phenyl]propanamide;methanesulfonic acid (PubChem CID 174299048) has the molecular formula C17H23N3O5S and a molecular weight of 381.45 g/mol. Its IUPAC name is 2-amino-2-methyl-3-[4-(pyridin-4-ylmethoxy)phenyl]propanamide;methanesulfonic acid.
| Compound Name | 2-amino-2-methyl-3-[4-(pyridin-4-ylmethoxy)phenyl]propanamide;methanesulfonic acid |
|---|---|
| PubChem CID | 174299048 |
| Molecular Formula | C17H23N3O5S |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 2-amino-2-methyl-3-[4-(pyridin-4-ylmethoxy)phenyl]propanamide;methanesulfonic acid |
| SMILES | CC(N)(Cc1ccc(OCc2ccncc2)cc1)C(N)=O.CS(=O)(=O)O |
| InChI | InChI=1S/C16H19N3O2.CH4O3S/c1-16(18,15(17)20)10-12-2-4-14(5-3-12)21-11-13-6-8-19-9-7-13;1-5(2,3)4/h2-9H,10-11,18H2,1H3,(H2,17,20);1H3,(H,2,3,4) |
| InChIKey | IWMHPMSVCUVTNE-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 145.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|