C12H19N3O — CID 171044369
(2S)-2-amino-2,3,3-trimethyl-4-pyridin-4-ylbutanamide (PubChem CID 171044369) has the molecular formula C12H19N3O and a molecular weight of 221.30 g/mol. Its IUPAC name is (2S)-2-amino-2,3,3-trimethyl-4-pyridin-4-ylbutanamide.
| Compound Name | (2S)-2-amino-2,3,3-trimethyl-4-pyridin-4-ylbutanamide |
|---|---|
| PubChem CID | 171044369 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | (2S)-2-amino-2,3,3-trimethyl-4-pyridin-4-ylbutanamide |
| SMILES | CC(C)(Cc1ccncc1)[C@](C)(N)C(N)=O |
| InChI | InChI=1S/C12H19N3O/c1-11(2,12(3,14)10(13)16)8-9-4-6-15-7-5-9/h4-7H,8,14H2,1-3H3,(H2,13,16)/t12-/m1/s1 |
| InChIKey | RQPLXGMFQBFVDU-GFCCVEGCSA-N |
| XLogP | 0.85 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |