C32H26O4 — CID 56934567
2-(2-methylprop-2-enyl)-1,5-bis(phenylmethoxy)anthracene-9,10-dione (PubChem CID 56934567) has the molecular formula C32H26O4 and a molecular weight of 474.56 g/mol. Its IUPAC name is 2-(2-methylprop-2-enyl)-1,5-bis(phenylmethoxy)anthracene-9,10-dione.
| Compound Name | 2-(2-methylprop-2-enyl)-1,5-bis(phenylmethoxy)anthracene-9,10-dione |
|---|---|
| PubChem CID | 56934567 |
| Molecular Formula | C32H26O4 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | 2-(2-methylprop-2-enyl)-1,5-bis(phenylmethoxy)anthracene-9,10-dione |
| SMILES | C=C(C)Cc1ccc2c(c1OCc1ccccc1)C(=O)c1cccc(OCc3ccccc3)c1C2=O |
| InChI | InChI=1S/C32H26O4/c1-21(2)18-24-16-17-26-29(32(24)36-20-23-12-7-4-8-13-23)31(34)25-14-9-15-27(28(25)30(26)33)35-19-22-10-5-3-6-11-22/h3-17H,1,18-20H2,2H3 |
| InChIKey | FGVKAJYDHVIWRP-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|