C32H34O5 — CID 11071107
11-(9,10-dioxo-1-phenylmethoxyanthracen-2-yl)undecanoic acid (PubChem CID 11071107) has the molecular formula C32H34O5 and a molecular weight of 498.62 g/mol. Its IUPAC name is 11-(9,10-dioxo-1-phenylmethoxyanthracen-2-yl)undecanoic acid.
| Compound Name | 11-(9,10-dioxo-1-phenylmethoxyanthracen-2-yl)undecanoic acid |
|---|---|
| PubChem CID | 11071107 |
| Molecular Formula | C32H34O5 |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | 11-(9,10-dioxo-1-phenylmethoxyanthracen-2-yl)undecanoic acid |
| SMILES | O=C(O)CCCCCCCCCCc1ccc2c(c1OCc1ccccc1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C32H34O5/c33-28(34)19-11-6-4-2-1-3-5-10-16-24-20-21-27-29(32(24)37-22-23-14-8-7-9-15-23)31(36)26-18-13-12-17-25(26)30(27)35/h7-9,12-15,17-18,20-21H,1-6,10-11,16,19,22H2,(H,33,34) |
| InChIKey | ZJQHRXNFPPKLLN-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|