C21H16BrNO4 — CID 71617639
1,8-dihydroxy-3-[(4-methylpyridin-1-ium-1-yl)methyl]anthracene-9,10-dione bromide (PubChem CID 71617639) has the molecular formula C21H16BrNO4 and a molecular weight of 426.27 g/mol. Its IUPAC name is 1,8-dihydroxy-3-[(4-methylpyridin-1-ium-1-yl)methyl]anthracene-9,10-dione bromide.
| Compound Name | 1,8-dihydroxy-3-[(4-methylpyridin-1-ium-1-yl)methyl]anthracene-9,10-dione bromide |
|---|---|
| PubChem CID | 71617639 |
| Molecular Formula | C21H16BrNO4 |
| Molecular Weight | 426.27 g/mol |
| Exact Mass | 425.03 |
| IUPAC Name | 1,8-dihydroxy-3-[(4-methylpyridin-1-ium-1-yl)methyl]anthracene-9,10-dione bromide |
| SMILES | Cc1cc[n+](Cc2cc(O)c3c(c2)C(=O)c2cccc(O)c2C3=O)cc1.[Br-] |
| InChI | InChI=1S/C21H15NO4.BrH/c1-12-5-7-22(8-6-12)11-13-9-15-19(17(24)10-13)21(26)18-14(20(15)25)3-2-4-16(18)23;/h2-10H,11H2,1H3,(H-,23,24,26);1H |
| InChIKey | UOIOWSJKPQHUIU-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 78.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.27 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|