C18H10O6-2 — CID 153484774
2-[4-(carboxylatomethyl)-9,10-dioxoanthracen-2-yl]acetate (PubChem CID 153484774) has the molecular formula C18H10O6-2 and a molecular weight of 322.27 g/mol. Its IUPAC name is 2-[4-(carboxylatomethyl)-9,10-dioxoanthracen-2-yl]acetate.
| Compound Name | 2-[4-(carboxylatomethyl)-9,10-dioxoanthracen-2-yl]acetate |
|---|---|
| PubChem CID | 153484774 |
| Molecular Formula | C18H10O6-2 |
| Molecular Weight | 322.27 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | 2-[4-(carboxylatomethyl)-9,10-dioxoanthracen-2-yl]acetate |
| SMILES | O=C([O-])Cc1cc(CC(=O)[O-])c2c(c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C18H12O6/c19-14(20)7-9-5-10(8-15(21)22)16-13(6-9)17(23)11-3-1-2-4-12(11)18(16)24/h1-6H,7-8H2,(H,19,20)(H,21,22)/p-2 |
| InChIKey | VESQKANRUQUMTH-UHFFFAOYSA-L |
| XLogP | -0.95 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.27 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|